C25H24F3N3O — CID 167038367
3-[4-[[3-(2-aminoprop-2-enyl)phenyl]methyl]-3-(trifluoromethyl)phenoxy]-2-(methyliminomethyl)aniline (PubChem CID 167038367) has the molecular formula C25H24F3N3O and a molecular weight of 439.48 g/mol. Its IUPAC name is 3-[4-[[3-(2-aminoprop-2-enyl)phenyl]methyl]-3-(trifluoromethyl)phenoxy]-2-(methyliminomethyl)aniline.
| Compound Name | 3-[4-[[3-(2-aminoprop-2-enyl)phenyl]methyl]-3-(trifluoromethyl)phenoxy]-2-(methyliminomethyl)aniline |
|---|---|
| PubChem CID | 167038367 |
| Molecular Formula | C25H24F3N3O |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 3-[4-[[3-(2-aminoprop-2-enyl)phenyl]methyl]-3-(trifluoromethyl)phenoxy]-2-(methyliminomethyl)aniline |
| SMILES | C=C(N)Cc1cccc(Cc2ccc(Oc3cccc(N)c3/C=N/C)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F3N3O/c1-16(29)11-17-5-3-6-18(12-17)13-19-9-10-20(14-22(19)25(26,27)28)32-24-8-4-7-23(30)21(24)15-31-2/h3-10,12,14-15H,1,11,13,29-30H2,2H3/b31-15+ |
| InChIKey | JASRZODBMBMKMI-IBBHUPRXSA-N |
| XLogP | 5.73 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|