C28H24FN5O4 — CID 135333545
ethyl 3-[4-[6-[2-(2-cyano-7-fluoro-4-methoxyindol-1-yl)ethylamino]pyrimidin-4-yl]-2-methoxyphenyl]prop-2-ynoate (PubChem CID 135333545) has the molecular formula C28H24FN5O4 and a molecular weight of 513.53 g/mol. Its IUPAC name is ethyl 3-[4-[6-[2-(2-cyano-7-fluoro-4-methoxyindol-1-yl)ethylamino]pyrimidin-4-yl]-2-methoxyphenyl]prop-2-ynoate.
| Compound Name | ethyl 3-[4-[6-[2-(2-cyano-7-fluoro-4-methoxyindol-1-yl)ethylamino]pyrimidin-4-yl]-2-methoxyphenyl]prop-2-ynoate |
|---|---|
| PubChem CID | 135333545 |
| Molecular Formula | C28H24FN5O4 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | ethyl 3-[4-[6-[2-(2-cyano-7-fluoro-4-methoxyindol-1-yl)ethylamino]pyrimidin-4-yl]-2-methoxyphenyl]prop-2-ynoate |
| SMILES | CCOC(=O)C#Cc1ccc(-c2cc(NCCn3c(C#N)cc4c(OC)ccc(F)c43)ncn2)cc1OC |
| InChI | InChI=1S/C28H24FN5O4/c1-4-38-27(35)10-7-18-5-6-19(13-25(18)37-3)23-15-26(33-17-32-23)31-11-12-34-20(16-30)14-21-24(36-2)9-8-22(29)28(21)34/h5-6,8-9,13-15,17H,4,11-12H2,1-3H3,(H,31,32,33) |
| InChIKey | ISPOHKBGVBKWCJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|