C26H20FN5O4 — CID 171991058
7-fluoro-1-[2-[[6-[4-(2-hydroxy-3,4-dioxocyclobutyl)phenyl]pyrimidin-4-yl]amino]ethyl]-4-methoxyindole-2-carbonitrile (PubChem CID 171991058) has the molecular formula C26H20FN5O4 and a molecular weight of 485.48 g/mol. Its IUPAC name is 7-fluoro-1-[2-[[6-[4-(2-hydroxy-3,4-dioxocyclobutyl)phenyl]pyrimidin-4-yl]amino]ethyl]-4-methoxyindole-2-carbonitrile.
| Compound Name | 7-fluoro-1-[2-[[6-[4-(2-hydroxy-3,4-dioxocyclobutyl)phenyl]pyrimidin-4-yl]amino]ethyl]-4-methoxyindole-2-carbonitrile |
|---|---|
| PubChem CID | 171991058 |
| Molecular Formula | C26H20FN5O4 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 7-fluoro-1-[2-[[6-[4-(2-hydroxy-3,4-dioxocyclobutyl)phenyl]pyrimidin-4-yl]amino]ethyl]-4-methoxyindole-2-carbonitrile |
| SMILES | COc1ccc(F)c2c1cc(C#N)n2CCNc1cc(-c2ccc(C3C(=O)C(=O)C3O)cc2)ncn1 |
| InChI | InChI=1S/C26H20FN5O4/c1-36-20-7-6-18(27)23-17(20)10-16(12-28)32(23)9-8-29-21-11-19(30-13-31-21)14-2-4-15(5-3-14)22-24(33)26(35)25(22)34/h2-7,10-11,13,22,24,33H,8-9H2,1H3,(H,29,30,31) |
| InChIKey | OGWNDMKFSHUEOV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|