C21H26ClN5O3 — CID 135335149
(2S)-2,6-diamino-N-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]hexanamide (PubChem CID 135335149) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]hexanamide |
|---|---|
| PubChem CID | 135335149 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]hexanamide |
| SMILES | COc1cc(OC)c(-c2cn3ccc(NC(=O)[C@@H](N)CCCCN)cc3n2)cc1Cl |
| InChI | InChI=1S/C21H26ClN5O3/c1-29-18-11-19(30-2)15(22)10-14(18)17-12-27-8-6-13(9-20(27)26-17)25-21(28)16(24)5-3-4-7-23/h6,8-12,16H,3-5,7,23-24H2,1-2H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | XPGLHRZISQYCGC-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|