C21H26ClN5O3 — CID 154702324
(2R)-2,6-diamino-N-[2-[5-chloro-2-(hydroxymethyl)-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]hexanamide (PubChem CID 154702324) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is (2R)-2,6-diamino-N-[2-[5-chloro-2-(hydroxymethyl)-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]hexanamide.
| Compound Name | (2R)-2,6-diamino-N-[2-[5-chloro-2-(hydroxymethyl)-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]hexanamide |
|---|---|
| PubChem CID | 154702324 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (2R)-2,6-diamino-N-[2-[5-chloro-2-(hydroxymethyl)-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]hexanamide |
| SMILES | COc1cc(CO)c(-c2cn3ccc(NC(=O)[C@H](N)CCCCN)cc3n2)cc1Cl |
| InChI | InChI=1S/C21H26ClN5O3/c1-30-19-8-13(12-28)15(10-16(19)22)18-11-27-7-5-14(9-20(27)26-18)25-21(29)17(24)4-2-3-6-23/h5,7-11,17,28H,2-4,6,12,23-24H2,1H3,(H,25,29)/t17-/m1/s1 |
| InChIKey | QPPDVYPROVAYED-QGZVFWFLSA-N |
| XLogP | 2.55 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|