C27H36N2O — CID 1353367
(1S,8aS)-1-cyclohexyl-2-[(3-phenylmethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 1353367) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is (1S,8aS)-1-cyclohexyl-2-[(3-phenylmethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1S,8aS)-1-cyclohexyl-2-[(3-phenylmethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 1353367 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (1S,8aS)-1-cyclohexyl-2-[(3-phenylmethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | c1ccc(COc2cccc(CN3CCN4CCC[C@H]4[C@@H]3C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C27H36N2O/c1-3-9-22(10-4-1)21-30-25-14-7-11-23(19-25)20-29-18-17-28-16-8-15-26(28)27(29)24-12-5-2-6-13-24/h1,3-4,7,9-11,14,19,24,26-27H,2,5-6,8,12-13,15-18,20-21H2/t26-,27-/m0/s1 |
| InChIKey | VGVHPQNRDXFRDX-SVBPBHIXSA-N |
| XLogP | 5.49 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |