C31H30FN5O3 — CID 135337720
(E)-2-[(2S)-2-[1-[4-(2-fluoro-3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile (PubChem CID 135337720) has the molecular formula C31H30FN5O3 and a molecular weight of 539.61 g/mol. Its IUPAC name is (E)-2-[(2S)-2-[1-[4-(2-fluoro-3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-[(2S)-2-[1-[4-(2-fluoro-3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 135337720 |
| Molecular Formula | C31H30FN5O3 |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | (E)-2-[(2S)-2-[1-[4-(2-fluoro-3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile |
| SMILES | COc1cccc(Oc2ccc(-c3nc([C@@H]4CCCN4C(=O)/C(C#N)=C/C(C)(C)C)n4ccncc34)cc2)c1F |
| InChI | InChI=1S/C31H30FN5O3/c1-31(2,3)17-21(18-33)30(38)37-15-6-7-23(37)29-35-28(24-19-34-14-16-36(24)29)20-10-12-22(13-11-20)40-26-9-5-8-25(39-4)27(26)32/h5,8-14,16-17,19,23H,6-7,15H2,1-4H3/b21-17+/t23-/m0/s1 |
| InChIKey | WHRMYOHREPCBCY-WTKRLXQWSA-N |
| XLogP | 6.50 |
| TPSA | 92.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|