C28H26N4O3 — CID 135337772
1-[2-[1-[4-(3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one (PubChem CID 135337772) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is 1-[2-[1-[4-(3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[2-[1-[4-(3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 135337772 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 1-[2-[1-[4-(3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCCC1c1nc(-c2ccc(Oc3cccc(OC)c3)cc2)c2cnccn12 |
| InChI | InChI=1S/C28H26N4O3/c1-3-7-26(33)31-16-5-4-10-24(31)28-30-27(25-19-29-15-17-32(25)28)20-11-13-21(14-12-20)35-23-9-6-8-22(18-23)34-2/h6,8-9,11-15,17-19,24H,4-5,10,16H2,1-2H3 |
| InChIKey | BKKJIUUEKPPIIK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|