C26H21ClN4O2 — CID 135337803
1-[(2S)-2-[1-(2-chloro-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 135337803) has the molecular formula C26H21ClN4O2 and a molecular weight of 456.93 g/mol. Its IUPAC name is 1-[(2S)-2-[1-(2-chloro-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[(2S)-2-[1-(2-chloro-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 135337803 |
| Molecular Formula | C26H21ClN4O2 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1-[(2S)-2-[1-(2-chloro-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC[C@H]1c1nc(-c2ccc(Oc3ccccc3)cc2Cl)c2cnccn12 |
| InChI | InChI=1S/C26H21ClN4O2/c1-2-7-24(32)30-14-6-10-22(30)26-29-25(23-17-28-13-15-31(23)26)20-12-11-19(16-21(20)27)33-18-8-4-3-5-9-18/h3-5,8-9,11-13,15-17,22H,6,10,14H2,1H3/t22-/m0/s1 |
| InChIKey | NRJNMMLXSFYQJU-QFIPXVFZSA-N |
| XLogP | 5.53 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|