C28H25FN4O2 — CID 139465835
1-[2-[1-[4-[(3-fluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one (PubChem CID 139465835) has the molecular formula C28H25FN4O2 and a molecular weight of 468.53 g/mol. Its IUPAC name is 1-[2-[1-[4-[(3-fluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[2-[1-[4-[(3-fluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 139465835 |
| Molecular Formula | C28H25FN4O2 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 1-[2-[1-[4-[(3-fluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCCC1c1nc(-c2ccc(OCc3cccc(F)c3)cc2)c2cnccn12 |
| InChI | InChI=1S/C28H25FN4O2/c1-2-6-26(34)32-15-4-3-9-24(32)28-31-27(25-18-30-14-16-33(25)28)21-10-12-23(13-11-21)35-19-20-7-5-8-22(29)17-20/h5,7-8,10-14,16-18,24H,3-4,9,15,19H2,1H3 |
| InChIKey | UANOKEHRBPWMEV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|