C25H21ClN4O2 — CID 139465929
1-[(2S)-2-[1-[4-(3-chlorophenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 139465929) has the molecular formula C25H21ClN4O2 and a molecular weight of 444.92 g/mol. Its IUPAC name is 1-[(2S)-2-[1-[4-(3-chlorophenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S)-2-[1-[4-(3-chlorophenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139465929 |
| Molecular Formula | C25H21ClN4O2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 1-[(2S)-2-[1-[4-(3-chlorophenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H]1c1nc(-c2ccc(Oc3cccc(Cl)c3)cc2)c2cnccn12 |
| InChI | InChI=1S/C25H21ClN4O2/c1-2-23(31)29-13-4-7-21(29)25-28-24(22-16-27-12-14-30(22)25)17-8-10-19(11-9-17)32-20-6-3-5-18(26)15-20/h2-3,5-6,8-12,14-16,21H,1,4,7,13H2/t21-/m0/s1 |
| InChIKey | AHMRDGGMOAZUNG-NRFANRHFSA-N |
| XLogP | 5.69 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|