C26H24N4O3 — CID 135337421
1-[2-[1-[4-(2-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 135337421) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-[2-[1-[4-(2-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[1-[4-(2-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135337421 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-[2-[1-[4-(2-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1c1nc(-c2ccc(Oc3ccccc3OC)cc2)c2cnccn12 |
| InChI | InChI=1S/C26H24N4O3/c1-3-24(31)29-15-6-7-20(29)26-28-25(21-17-27-14-16-30(21)26)18-10-12-19(13-11-18)33-23-9-5-4-8-22(23)32-2/h3-5,8-14,16-17,20H,1,6-7,15H2,2H3 |
| InChIKey | OGQIUBDFALKWBG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|