C25H21N5O2 — CID 135338100
1-[(2S)-2-[1-(5-phenoxy-2-pyridinyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 135338100) has the molecular formula C25H21N5O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 1-[(2S)-2-[1-(5-phenoxy-2-pyridinyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[(2S)-2-[1-(5-phenoxy-2-pyridinyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 135338100 |
| Molecular Formula | C25H21N5O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[(2S)-2-[1-(5-phenoxy-2-pyridinyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC[C@H]1c1nc(-c2ccc(Oc3ccccc3)cn2)c2cnccn12 |
| InChI | InChI=1S/C25H21N5O2/c1-2-7-23(31)29-14-6-10-21(29)25-28-24(22-17-26-13-15-30(22)25)20-12-11-19(16-27-20)32-18-8-4-3-5-9-18/h3-5,8-9,11-13,15-17,21H,6,10,14H2,1H3/t21-/m0/s1 |
| InChIKey | CHFVKQLCNBSKGE-NRFANRHFSA-N |
| XLogP | 4.27 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|