C16H21F3N4O4 — CID 135342085
[2-methyl-1-[6-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]propan-2-yl] acetate (PubChem CID 135342085) has the molecular formula C16H21F3N4O4 and a molecular weight of 390.36 g/mol. Its IUPAC name is [2-methyl-1-[6-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]propan-2-yl] acetate.
| Compound Name | [2-methyl-1-[6-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]propan-2-yl] acetate |
|---|---|
| PubChem CID | 135342085 |
| Molecular Formula | C16H21F3N4O4 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [2-methyl-1-[6-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]propan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)CN1CC2(CC(n3cc([N+](=O)[O-])c(C(F)(F)F)n3)C2)C1 |
| InChI | InChI=1S/C16H21F3N4O4/c1-10(24)27-14(2,3)7-21-8-15(9-21)4-11(5-15)22-6-12(23(25)26)13(20-22)16(17,18)19/h6,11H,4-5,7-9H2,1-3H3 |
| InChIKey | FRNIHGZJGYAKDU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|