C15H13Cl2N3O3 — CID 135344421
[2-[(6,8-dichloro-2,7-naphthyridin-3-yl)carbamoyl]cyclopropyl]methyl acetate (PubChem CID 135344421) has the molecular formula C15H13Cl2N3O3 and a molecular weight of 354.19 g/mol. Its IUPAC name is [2-[(6,8-dichloro-2,7-naphthyridin-3-yl)carbamoyl]cyclopropyl]methyl acetate.
| Compound Name | [2-[(6,8-dichloro-2,7-naphthyridin-3-yl)carbamoyl]cyclopropyl]methyl acetate |
|---|---|
| PubChem CID | 135344421 |
| Molecular Formula | C15H13Cl2N3O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | [2-[(6,8-dichloro-2,7-naphthyridin-3-yl)carbamoyl]cyclopropyl]methyl acetate |
| SMILES | CC(=O)OCC1CC1C(=O)Nc1cc2cc(Cl)nc(Cl)c2cn1 |
| InChI | InChI=1S/C15H13Cl2N3O3/c1-7(21)23-6-9-2-10(9)15(22)20-13-4-8-3-12(16)19-14(17)11(8)5-18-13/h3-5,9-10H,2,6H2,1H3,(H,18,20,22) |
| InChIKey | RSESCISXTMPNBP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|