C16H11Cl2N5O — CID 139469059
trans-(1S,2S)-N-(6,8-dichloro-2,7-naphthyridin-3-yl)-2-pyrimidin-2-ylcyclopropane-1-carboxamide (PubChem CID 139469059) has the molecular formula C16H11Cl2N5O and a molecular weight of 360.20 g/mol. Its IUPAC name is trans-(1S,2S)-N-(6,8-dichloro-2,7-naphthyridin-3-yl)-2-pyrimidin-2-ylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-(6,8-dichloro-2,7-naphthyridin-3-yl)-2-pyrimidin-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 139469059 |
| Molecular Formula | C16H11Cl2N5O |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | trans-(1S,2S)-N-(6,8-dichloro-2,7-naphthyridin-3-yl)-2-pyrimidin-2-ylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cc2cc(Cl)nc(Cl)c2cn1)[C@H]1C[C@@H]1c1ncccn1 |
| InChI | InChI=1S/C16H11Cl2N5O/c17-12-4-8-5-13(21-7-11(8)14(18)22-12)23-16(24)10-6-9(10)15-19-2-1-3-20-15/h1-5,7,9-10H,6H2,(H,21,23,24)/t9-,10-/m0/s1 |
| InChIKey | NHDMSTJXTIRXTR-UWVGGRQHSA-N |
| XLogP | 3.47 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|