C13H13ClN4O — CID 139468919
cis-(1R,2S)-N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-methylcyclopropane-1-carboxamide (PubChem CID 139468919) has the molecular formula C13H13ClN4O and a molecular weight of 276.73 g/mol. Its IUPAC name is cis-(1R,2S)-N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 139468919 |
| Molecular Formula | C13H13ClN4O |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | cis-(1R,2S)-N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-methylcyclopropane-1-carboxamide |
| SMILES | C[C@H]1C[C@H]1C(=O)Nc1cc2cc(Cl)nc(N)c2cn1 |
| InChI | InChI=1S/C13H13ClN4O/c1-6-2-8(6)13(19)18-11-4-7-3-10(14)17-12(15)9(7)5-16-11/h3-6,8H,2H2,1H3,(H2,15,17)(H,16,18,19)/t6-,8+/m0/s1 |
| InChIKey | GCNMQRQLWLMPMM-POYBYMJQSA-N |
| XLogP | 2.46 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|