C12H13ClN4O2 — CID 135344727
N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-hydroxy-2-methylpropanamide (PubChem CID 135344727) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-hydroxy-2-methylpropanamide.
| Compound Name | N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 135344727 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-(8-amino-6-chloro-2,7-naphthyridin-3-yl)-2-hydroxy-2-methylpropanamide |
| SMILES | CC(C)(O)C(=O)Nc1cc2cc(Cl)nc(N)c2cn1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-12(2,19)11(18)17-9-4-6-3-8(13)16-10(14)7(6)5-15-9/h3-5,19H,1-2H3,(H2,14,16)(H,15,17,18) |
| InChIKey | SWMGXVUVGWEIED-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|