C16H20N4O3S — CID 142447992
trans-(1R,2R)-N-[8-amino-6-(dimethylsulfamoyl)isoquinolin-3-yl]-2-methylcyclopropane-1-carboxamide (PubChem CID 142447992) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is trans-(1R,2R)-N-[8-amino-6-(dimethylsulfamoyl)isoquinolin-3-yl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[8-amino-6-(dimethylsulfamoyl)isoquinolin-3-yl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142447992 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | trans-(1R,2R)-N-[8-amino-6-(dimethylsulfamoyl)isoquinolin-3-yl]-2-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@H]1C(=O)Nc1cc2cc(S(=O)(=O)N(C)C)cc(N)c2cn1 |
| InChI | InChI=1S/C16H20N4O3S/c1-9-4-12(9)16(21)19-15-6-10-5-11(24(22,23)20(2)3)7-14(17)13(10)8-18-15/h5-9,12H,4,17H2,1-3H3,(H,18,19,21)/t9-,12-/m1/s1 |
| InChIKey | ZDPFRPYGKNYBPD-BXKDBHETSA-N |
| XLogP | 1.66 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|