C10H11Cl2IN2 — CID 135344749
N-tert-butyl-1-(2,6-dichloro-4-iodo-3-pyridinyl)methanimine (PubChem CID 135344749) has the molecular formula C10H11Cl2IN2 and a molecular weight of 357.02 g/mol. Its IUPAC name is N-tert-butyl-1-(2,6-dichloro-4-iodo-3-pyridinyl)methanimine.
| Compound Name | N-tert-butyl-1-(2,6-dichloro-4-iodo-3-pyridinyl)methanimine |
|---|---|
| PubChem CID | 135344749 |
| Molecular Formula | C10H11Cl2IN2 |
| Molecular Weight | 357.02 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | N-tert-butyl-1-(2,6-dichloro-4-iodo-3-pyridinyl)methanimine |
| SMILES | CC(C)(C)/N=C/c1c(I)cc(Cl)nc1Cl |
| InChI | InChI=1S/C10H11Cl2IN2/c1-10(2,3)14-5-6-7(13)4-8(11)15-9(6)12/h4-5H,1-3H3/b14-5+ |
| InChIKey | VUARBUDQXUUCFI-LHHJGKSTSA-N |
| XLogP | 4.21 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.02 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|