C7H3Cl2IN2 — CID 118991371
4,6-dichloro-3-iodo-1H-pyrrolo[3,2-c]pyridine (PubChem CID 118991371) has the molecular formula C7H3Cl2IN2 and a molecular weight of 312.93 g/mol. Its IUPAC name is 4,6-dichloro-3-iodo-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 4,6-dichloro-3-iodo-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 118991371 |
| Molecular Formula | C7H3Cl2IN2 |
| Molecular Weight | 312.93 g/mol |
| Exact Mass | 311.87 |
| IUPAC Name | 4,6-dichloro-3-iodo-1H-pyrrolo[3,2-c]pyridine |
| SMILES | Clc1cc2[nH]cc(I)c2c(Cl)n1 |
| InChI | InChI=1S/C7H3Cl2IN2/c8-5-1-4-6(7(9)12-5)3(10)2-11-4/h1-2,11H |
| InChIKey | MVGQGLDRYWKZTN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|