C5H3Cl2IN2 — CID 86049608
4,6-dichloro-2-(iodomethyl)pyrimidine (PubChem CID 86049608) has the molecular formula C5H3Cl2IN2 and a molecular weight of 288.90 g/mol. Its IUPAC name is 4,6-dichloro-2-(iodomethyl)pyrimidine.
| Compound Name | 4,6-dichloro-2-(iodomethyl)pyrimidine |
|---|---|
| PubChem CID | 86049608 |
| Molecular Formula | C5H3Cl2IN2 |
| Molecular Weight | 288.90 g/mol |
| Exact Mass | 287.87 |
| IUPAC Name | 4,6-dichloro-2-(iodomethyl)pyrimidine |
| SMILES | Clc1cc(Cl)nc(CI)n1 |
| InChI | InChI=1S/C5H3Cl2IN2/c6-3-1-4(7)10-5(2-8)9-3/h1H,2H2 |
| InChIKey | VNBRQTMTJZUZMY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.90 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|