C20H30N4O2S — CID 135347933
(2S)-N-[(2S,3S)-1-amino-3-methylpentan-2-yl]-2-formamido-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 135347933) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is (2S)-N-[(2S,3S)-1-amino-3-methylpentan-2-yl]-2-formamido-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | (2S)-N-[(2S,3S)-1-amino-3-methylpentan-2-yl]-2-formamido-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 135347933 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (2S)-N-[(2S,3S)-1-amino-3-methylpentan-2-yl]-2-formamido-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | CC[C@H](C)[C@@H](CN)NC(=O)[C@H](Cc1nc2ccc(C(C)C)cc2s1)NC=O |
| InChI | InChI=1S/C20H30N4O2S/c1-5-13(4)17(10-21)24-20(26)16(22-11-25)9-19-23-15-7-6-14(12(2)3)8-18(15)27-19/h6-8,11-13,16-17H,5,9-10,21H2,1-4H3,(H,22,25)(H,24,26)/t13-,16-,17+/m0/s1 |
| InChIKey | LSSQAPCEJHYVIY-RRQGHBQHSA-N |
| XLogP | 2.57 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|