C19H28N6OS — CID 135350701
2-amino-N-(1-azido-3-methylpentan-2-yl)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 135350701) has the molecular formula C19H28N6OS and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-amino-N-(1-azido-3-methylpentan-2-yl)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 2-amino-N-(1-azido-3-methylpentan-2-yl)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 135350701 |
| Molecular Formula | C19H28N6OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-amino-N-(1-azido-3-methylpentan-2-yl)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | CCC(C)C(CN=[N+]=[N-])NC(=O)C(N)Cc1nc2ccc(C(C)C)cc2s1 |
| InChI | InChI=1S/C19H28N6OS/c1-5-12(4)16(10-22-25-21)24-19(26)14(20)9-18-23-15-7-6-13(11(2)3)8-17(15)27-18/h6-8,11-12,14,16H,5,9-10,20H2,1-4H3,(H,24,26) |
| InChIKey | XXXXCMHYFYUHNO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|