C28H40N2O9 — CID 135351207
(6aS)-3-(6-ethoxy-6-oxohexoxy)-2-methoxy-6-(oxan-2-yloxy)-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylic acid (PubChem CID 135351207) has the molecular formula C28H40N2O9 and a molecular weight of 548.63 g/mol. Its IUPAC name is (6aS)-3-(6-ethoxy-6-oxohexoxy)-2-methoxy-6-(oxan-2-yloxy)-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylic acid.
| Compound Name | (6aS)-3-(6-ethoxy-6-oxohexoxy)-2-methoxy-6-(oxan-2-yloxy)-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylic acid |
|---|---|
| PubChem CID | 135351207 |
| Molecular Formula | C28H40N2O9 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | (6aS)-3-(6-ethoxy-6-oxohexoxy)-2-methoxy-6-(oxan-2-yloxy)-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylic acid |
| SMILES | CCOC(=O)CCCCCOc1cc2c(cc1OC)C(=O)N1CCCC[C@H]1C(OC1CCCCO1)N2C(=O)O |
| InChI | InChI=1S/C28H40N2O9/c1-3-36-24(31)12-5-4-9-15-37-23-18-21-19(17-22(23)35-2)26(32)29-14-8-6-11-20(29)27(30(21)28(33)34)39-25-13-7-10-16-38-25/h17-18,20,25,27H,3-16H2,1-2H3,(H,33,34)/t20-,25?,27?/m0/s1 |
| InChIKey | ZKVPAVUNCIQLAP-LAWLFLRMSA-N |
| XLogP | 4.56 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|