C26H36N2O8 — CID 126640086
prop-2-enyl 3-(6-ethoxy-6-oxohexoxy)-6-hydroxy-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 126640086) has the molecular formula C26H36N2O8 and a molecular weight of 504.58 g/mol. Its IUPAC name is prop-2-enyl 3-(6-ethoxy-6-oxohexoxy)-6-hydroxy-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | prop-2-enyl 3-(6-ethoxy-6-oxohexoxy)-6-hydroxy-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 126640086 |
| Molecular Formula | C26H36N2O8 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | prop-2-enyl 3-(6-ethoxy-6-oxohexoxy)-6-hydroxy-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | C=CCOC(=O)N1c2cc(OCCCCCC(=O)OCC)c(OC)cc2C(=O)N2CCCCC2C1O |
| InChI | InChI=1S/C26H36N2O8/c1-4-14-36-26(32)28-20-17-22(35-15-10-6-7-12-23(29)34-5-2)21(33-3)16-18(20)24(30)27-13-9-8-11-19(27)25(28)31/h4,16-17,19,25,31H,1,5-15H2,2-3H3 |
| InChIKey | LEYDCCZREPXGSG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|