C25H31Cl3N2O8 — CID 11103931
prop-2-enyl (6aS)-6-hydroxy-2-methoxy-11-oxo-3-[6-oxo-6-(2,2,2-trichloroethoxy)hexoxy]-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 11103931) has the molecular formula C25H31Cl3N2O8 and a molecular weight of 593.89 g/mol. Its IUPAC name is prop-2-enyl (6aS)-6-hydroxy-2-methoxy-11-oxo-3-[6-oxo-6-(2,2,2-trichloroethoxy)hexoxy]-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | prop-2-enyl (6aS)-6-hydroxy-2-methoxy-11-oxo-3-[6-oxo-6-(2,2,2-trichloroethoxy)hexoxy]-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 11103931 |
| Molecular Formula | C25H31Cl3N2O8 |
| Molecular Weight | 593.89 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | prop-2-enyl (6aS)-6-hydroxy-2-methoxy-11-oxo-3-[6-oxo-6-(2,2,2-trichloroethoxy)hexoxy]-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | C=CCOC(=O)N1c2cc(OCCCCCC(=O)OCC(Cl)(Cl)Cl)c(OC)cc2C(=O)N2CCC[C@H]2C1O |
| InChI | InChI=1S/C25H31Cl3N2O8/c1-3-11-37-24(34)30-18-14-20(36-12-6-4-5-9-21(31)38-15-25(26,27)28)19(35-2)13-16(18)22(32)29-10-7-8-17(29)23(30)33/h3,13-14,17,23,33H,1,4-12,15H2,2H3/t17-,23?/m0/s1 |
| InChIKey | TZSQNMPLXSMOEN-NVHKAFQKSA-N |
| XLogP | 4.61 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|