C20H23Cl3N2O7 — CID 71167871
2,2,2-trichloroethyl (6S,6aS)-3-butoxy-6-hydroxy-2-methoxy-8,11-dioxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 71167871) has the molecular formula C20H23Cl3N2O7 and a molecular weight of 509.77 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S,6aS)-3-butoxy-6-hydroxy-2-methoxy-8,11-dioxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S,6aS)-3-butoxy-6-hydroxy-2-methoxy-8,11-dioxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 71167871 |
| Molecular Formula | C20H23Cl3N2O7 |
| Molecular Weight | 509.77 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | 2,2,2-trichloroethyl (6S,6aS)-3-butoxy-6-hydroxy-2-methoxy-8,11-dioxo-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | CCCCOc1cc2c(cc1OC)C(=O)N1CC(=O)C[C@H]1[C@H](O)N2C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H23Cl3N2O7/c1-3-4-5-31-16-8-13-12(7-15(16)30-2)17(27)24-9-11(26)6-14(24)18(28)25(13)19(29)32-10-20(21,22)23/h7-8,14,18,28H,3-6,9-10H2,1-2H3/t14-,18-/m0/s1 |
| InChIKey | KIRXBBKLAXYSPD-KSSFIOAISA-N |
| XLogP | 3.30 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.77 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|