C23H32N2O8 — CID 135351136
(6aS)-3-(6-ethoxy-6-oxohexoxy)-6-hydroxy-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylic acid (PubChem CID 135351136) has the molecular formula C23H32N2O8 and a molecular weight of 464.52 g/mol. Its IUPAC name is (6aS)-3-(6-ethoxy-6-oxohexoxy)-6-hydroxy-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylic acid.
| Compound Name | (6aS)-3-(6-ethoxy-6-oxohexoxy)-6-hydroxy-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylic acid |
|---|---|
| PubChem CID | 135351136 |
| Molecular Formula | C23H32N2O8 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (6aS)-3-(6-ethoxy-6-oxohexoxy)-6-hydroxy-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-5-carboxylic acid |
| SMILES | CCOC(=O)CCCCCOc1cc2c(cc1OC)C(=O)N1CCCC[C@H]1C(O)N2C(=O)O |
| InChI | InChI=1S/C23H32N2O8/c1-3-32-20(26)10-5-4-8-12-33-19-14-17-15(13-18(19)31-2)21(27)24-11-7-6-9-16(24)22(28)25(17)23(29)30/h13-14,16,22,28H,3-12H2,1-2H3,(H,29,30)/t16-,22?/m0/s1 |
| InChIKey | RQNLLUZOOOARAA-CISYCMJJSA-N |
| XLogP | 3.01 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|