C32H34F2N4O5S2 — CID 135352052
N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-4-(fluoromethyl)-2-(4-fluorophenyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 135352052) has the molecular formula C32H34F2N4O5S2 and a molecular weight of 656.78 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-4-(fluoromethyl)-2-(4-fluorophenyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-4-(fluoromethyl)-2-(4-fluorophenyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 135352052 |
| Molecular Formula | C32H34F2N4O5S2 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.19 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-4-(fluoromethyl)-2-(4-fluorophenyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2ccc3c(c2)OCCC3N2CC[C@@H](CF)C[C@H]2c2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C32H34F2N4O5S2/c1-41-25-8-5-23(30(16-25)42-2)19-38(32-35-20-36-44-32)45(39,40)26-9-10-27-28(12-14-43-31(27)17-26)37-13-11-21(18-33)15-29(37)22-3-6-24(34)7-4-22/h3-10,16-17,20-21,28-29H,11-15,18-19H2,1-2H3/t21-,28?,29+/m1/s1 |
| InChIKey | DCWNPUFFJVQCCP-ZXSJHISUSA-N |
| XLogP | 6.34 |
| TPSA | 94.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |