C30H32N4O5S2 — CID 146729633
(4R)-N-[(2,4-dimethoxyphenyl)methyl]-4-[(1R)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 146729633) has the molecular formula C30H32N4O5S2 and a molecular weight of 592.74 g/mol. Its IUPAC name is (4R)-N-[(2,4-dimethoxyphenyl)methyl]-4-[(1R)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | (4R)-N-[(2,4-dimethoxyphenyl)methyl]-4-[(1R)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 146729633 |
| Molecular Formula | C30H32N4O5S2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | (4R)-N-[(2,4-dimethoxyphenyl)methyl]-4-[(1R)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2ccc3c(c2)OCC[C@H]3N2CCc3ccccc3[C@H]2C)c(OC)c1 |
| InChI | InChI=1S/C30H32N4O5S2/c1-20-25-7-5-4-6-21(25)12-14-33(20)27-13-15-39-29-17-24(10-11-26(27)29)41(35,36)34(30-31-19-32-40-30)18-22-8-9-23(37-2)16-28(22)38-3/h4-11,16-17,19-20,27H,12-15,18H2,1-3H3/t20-,27-/m1/s1 |
| InChIKey | RHEDYBJCJPDZQB-NFQMXDRXSA-N |
| XLogP | 5.39 |
| TPSA | 94.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |