C32H32F4N4O6S2 — CID 135352238
(4S)-N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-2-(4-fluorophenyl)-4-(trifluoromethoxy)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 135352238) has the molecular formula C32H32F4N4O6S2 and a molecular weight of 708.76 g/mol. Its IUPAC name is (4S)-N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-2-(4-fluorophenyl)-4-(trifluoromethoxy)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | (4S)-N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-2-(4-fluorophenyl)-4-(trifluoromethoxy)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 135352238 |
| Molecular Formula | C32H32F4N4O6S2 |
| Molecular Weight | 708.76 g/mol |
| Exact Mass | 708.17 |
| IUPAC Name | (4S)-N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-2-(4-fluorophenyl)-4-(trifluoromethoxy)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2ccc3c(c2)OCC[C@@H]3N2CC[C@@H](OC(F)(F)F)C[C@H]2c2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C32H32F4N4O6S2/c1-43-23-8-5-21(29(16-23)44-2)18-40(31-37-19-38-47-31)48(41,42)25-9-10-26-27(12-14-45-30(26)17-25)39-13-11-24(46-32(34,35)36)15-28(39)20-3-6-22(33)7-4-20/h3-10,16-17,19,24,27-28H,11-15,18H2,1-2H3/t24-,27+,28+/m1/s1 |
| InChIKey | OFYPHHVWXYAIKR-KGPYPHOUSA-N |
| XLogP | 6.66 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.76 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |