C22H27N3O4 — CID 135353132
methyl 1-[(2S)-2-amino-3-(3-phenylmethoxyphenyl)propanoyl]diazinane-3-carboxylate (PubChem CID 135353132) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is methyl 1-[(2S)-2-amino-3-(3-phenylmethoxyphenyl)propanoyl]diazinane-3-carboxylate.
| Compound Name | methyl 1-[(2S)-2-amino-3-(3-phenylmethoxyphenyl)propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 135353132 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | methyl 1-[(2S)-2-amino-3-(3-phenylmethoxyphenyl)propanoyl]diazinane-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)[C@@H](N)Cc2cccc(OCc3ccccc3)c2)N1 |
| InChI | InChI=1S/C22H27N3O4/c1-28-22(27)20-11-6-12-25(24-20)21(26)19(23)14-17-9-5-10-18(13-17)29-15-16-7-3-2-4-8-16/h2-5,7-10,13,19-20,24H,6,11-12,14-15,23H2,1H3/t19-,20?/m0/s1 |
| InChIKey | XNBJLPUIFFHLPV-XJDOXCRVSA-N |
| XLogP | 1.80 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |