C19H17N3O2S — CID 135354759
2-[1-[(4-cyanophenyl)methyl]benzimidazol-2-yl]sulfanyl-2-methylpropanoic acid (PubChem CID 135354759) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[1-[(4-cyanophenyl)methyl]benzimidazol-2-yl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[1-[(4-cyanophenyl)methyl]benzimidazol-2-yl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 135354759 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-[1-[(4-cyanophenyl)methyl]benzimidazol-2-yl]sulfanyl-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1nc2ccccc2n1Cc1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C19H17N3O2S/c1-19(2,17(23)24)25-18-21-15-5-3-4-6-16(15)22(18)12-14-9-7-13(11-20)8-10-14/h3-10H,12H2,1-2H3,(H,23,24) |
| InChIKey | IXDUSWQZJYOTSD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |