C18H18N4 — CID 82359745
4-[[2-(propylamino)benzimidazol-1-yl]methyl]benzonitrile (PubChem CID 82359745) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-[[2-(propylamino)benzimidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[2-(propylamino)benzimidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 82359745 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-[[2-(propylamino)benzimidazol-1-yl]methyl]benzonitrile |
| SMILES | CCCNc1nc2ccccc2n1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H18N4/c1-2-11-20-18-21-16-5-3-4-6-17(16)22(18)13-15-9-7-14(12-19)8-10-15/h3-10H,2,11,13H2,1H3,(H,20,21) |
| InChIKey | ZDGXYJGJJVKMSC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |