C23H19N5OS — CID 139841677
1-(4-cyanophenyl)-3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]thiourea (PubChem CID 139841677) has the molecular formula C23H19N5OS and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]thiourea.
| Compound Name | 1-(4-cyanophenyl)-3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]thiourea |
|---|---|
| PubChem CID | 139841677 |
| Molecular Formula | C23H19N5OS |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]thiourea |
| SMILES | COc1ccc(Cn2c(NC(=S)Nc3ccc(C#N)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H19N5OS/c1-29-19-12-8-17(9-13-19)15-28-21-5-3-2-4-20(21)26-22(28)27-23(30)25-18-10-6-16(14-24)7-11-18/h2-13H,15H2,1H3,(H2,25,26,27,30) |
| InChIKey | FPBBHTCBUFYSHE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|