C21H19N5O2S2 — CID 139841650
1-(1-benzylbenzimidazol-2-yl)-3-(4-sulfamoylphenyl)thiourea (PubChem CID 139841650) has the molecular formula C21H19N5O2S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 1-(1-benzylbenzimidazol-2-yl)-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(1-benzylbenzimidazol-2-yl)-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 139841650 |
| Molecular Formula | C21H19N5O2S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 1-(1-benzylbenzimidazol-2-yl)-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)Nc2nc3ccccc3n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H19N5O2S2/c22-30(27,28)17-12-10-16(11-13-17)23-21(29)25-20-24-18-8-4-5-9-19(18)26(20)14-15-6-2-1-3-7-15/h1-13H,14H2,(H2,22,27,28)(H2,23,24,25,29) |
| InChIKey | DEJXUOXTJNZKJI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|