C20H19N3O2S — CID 7133782
(4-cyanophenyl)methyl 2-(1-propylbenzimidazol-2-yl)sulfanylacetate (PubChem CID 7133782) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(1-propylbenzimidazol-2-yl)sulfanylacetate.
| Compound Name | (4-cyanophenyl)methyl 2-(1-propylbenzimidazol-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7133782 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (4-cyanophenyl)methyl 2-(1-propylbenzimidazol-2-yl)sulfanylacetate |
| SMILES | CCCn1c(SCC(=O)OCc2ccc(C#N)cc2)nc2ccccc21 |
| InChI | InChI=1S/C20H19N3O2S/c1-2-11-23-18-6-4-3-5-17(18)22-20(23)26-14-19(24)25-13-16-9-7-15(12-21)8-10-16/h3-10H,2,11,13-14H2,1H3 |
| InChIKey | QAYYKLKRIIMVSG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |