C28H57N — CID 135356098
N-methyl-1-[(1S,2R)-2-octylcyclopropyl]hexadecan-8-amine (PubChem CID 135356098) has the molecular formula C28H57N and a molecular weight of 407.77 g/mol. Its IUPAC name is N-methyl-1-[(1S,2R)-2-octylcyclopropyl]hexadecan-8-amine.
| Compound Name | N-methyl-1-[(1S,2R)-2-octylcyclopropyl]hexadecan-8-amine |
|---|---|
| PubChem CID | 135356098 |
| Molecular Formula | C28H57N |
| Molecular Weight | 407.77 g/mol |
| Exact Mass | 407.45 |
| IUPAC Name | N-methyl-1-[(1S,2R)-2-octylcyclopropyl]hexadecan-8-amine |
| SMILES | CCCCCCCCC(CCCCCCC[C@H]1C[C@H]1CCCCCCCC)NC |
| InChI | InChI=1S/C28H57N/c1-4-6-8-10-13-17-21-26-25-27(26)22-18-14-12-16-20-24-28(29-3)23-19-15-11-9-7-5-2/h26-29H,4-25H2,1-3H3/t26-,27+,28?/m1/s1 |
| InChIKey | IUCSKBCFDVGBGB-ANUFDVCNSA-N |
| XLogP | 9.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.77 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|