C24H22N6O2 — CID 135356723
3-(4-piperidin-4-ylphenyl)-5-(4-pyrazin-2-yltriazol-1-yl)benzoic acid (PubChem CID 135356723) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 3-(4-piperidin-4-ylphenyl)-5-(4-pyrazin-2-yltriazol-1-yl)benzoic acid.
| Compound Name | 3-(4-piperidin-4-ylphenyl)-5-(4-pyrazin-2-yltriazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 135356723 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-(4-piperidin-4-ylphenyl)-5-(4-pyrazin-2-yltriazol-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3cnccn3)nn2)c1 |
| InChI | InChI=1S/C24H22N6O2/c31-24(32)20-11-19(17-3-1-16(2-4-17)18-5-7-25-8-6-18)12-21(13-20)30-15-23(28-29-30)22-14-26-9-10-27-22/h1-4,9-15,18,25H,5-8H2,(H,31,32) |
| InChIKey | IFTJITSFPMCWIG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |