C25H23N5O2 — CID 135356979
3-(4-piperidin-4-ylphenyl)-5-(4-pyridin-4-yltriazol-1-yl)benzoic acid (PubChem CID 135356979) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-(4-piperidin-4-ylphenyl)-5-(4-pyridin-4-yltriazol-1-yl)benzoic acid.
| Compound Name | 3-(4-piperidin-4-ylphenyl)-5-(4-pyridin-4-yltriazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 135356979 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-(4-piperidin-4-ylphenyl)-5-(4-pyridin-4-yltriazol-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3ccncc3)nn2)c1 |
| InChI | InChI=1S/C25H23N5O2/c31-25(32)22-13-21(18-3-1-17(2-4-18)19-5-9-26-10-6-19)14-23(15-22)30-16-24(28-29-30)20-7-11-27-12-8-20/h1-4,7-8,11-16,19,26H,5-6,9-10H2,(H,31,32) |
| InChIKey | LJDHETKRPNEOMJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |