C29H26BrClN2O3 — CID 135357321
6-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-(2-chlorophenyl)hexanoic acid (PubChem CID 135357321) has the molecular formula C29H26BrClN2O3 and a molecular weight of 565.90 g/mol. Its IUPAC name is 6-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-(2-chlorophenyl)hexanoic acid.
| Compound Name | 6-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-(2-chlorophenyl)hexanoic acid |
|---|---|
| PubChem CID | 135357321 |
| Molecular Formula | C29H26BrClN2O3 |
| Molecular Weight | 565.90 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | 6-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-(2-chlorophenyl)hexanoic acid |
| SMILES | Cc1c(-c2ccccc2)nc2ccc(Br)cc2c1C(=O)NCC(CCCC(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C29H26BrClN2O3/c1-18-27(23-16-21(30)14-15-25(23)33-28(18)19-8-3-2-4-9-19)29(36)32-17-20(10-7-13-26(34)35)22-11-5-6-12-24(22)31/h2-6,8-9,11-12,14-16,20H,7,10,13,17H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | ZIDVHLLOHYVUEZ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.90 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |