C18H16N2O5 — CID 135357506
4-[[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]benzoic acid (PubChem CID 135357506) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-[[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 135357506 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]benzoic acid |
| SMILES | COc1ccc(-c2nc(Cc3ccc(C(=O)O)cc3)no2)cc1OC |
| InChI | InChI=1S/C18H16N2O5/c1-23-14-8-7-13(10-15(14)24-2)17-19-16(20-25-17)9-11-3-5-12(6-4-11)18(21)22/h3-8,10H,9H2,1-2H3,(H,21,22) |
| InChIKey | JRFSJTZWQFOINV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |