C20H22IN3O2 — CID 135358994
2-ethyl-3-[(2-hydroxyethylamino)methyl]-4-[(7-iodoquinolin-4-yl)amino]phenol (PubChem CID 135358994) has the molecular formula C20H22IN3O2 and a molecular weight of 463.32 g/mol. Its IUPAC name is 2-ethyl-3-[(2-hydroxyethylamino)methyl]-4-[(7-iodoquinolin-4-yl)amino]phenol.
| Compound Name | 2-ethyl-3-[(2-hydroxyethylamino)methyl]-4-[(7-iodoquinolin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 135358994 |
| Molecular Formula | C20H22IN3O2 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 2-ethyl-3-[(2-hydroxyethylamino)methyl]-4-[(7-iodoquinolin-4-yl)amino]phenol |
| SMILES | CCc1c(O)ccc(Nc2ccnc3cc(I)ccc23)c1CNCCO |
| InChI | InChI=1S/C20H22IN3O2/c1-2-14-16(12-22-9-10-25)17(5-6-20(14)26)24-18-7-8-23-19-11-13(21)3-4-15(18)19/h3-8,11,22,25-26H,2,9-10,12H2,1H3,(H,23,24) |
| InChIKey | FEVGMLWPRAMYRE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|