C21H26IN3O — CID 153301338
6-[[ethyl(propyl)amino]methyl]-4-[(7-iodoquinolin-4-yl)amino]cyclohexa-2,4-dien-1-ol (PubChem CID 153301338) has the molecular formula C21H26IN3O and a molecular weight of 463.36 g/mol. Its IUPAC name is 6-[[ethyl(propyl)amino]methyl]-4-[(7-iodoquinolin-4-yl)amino]cyclohexa-2,4-dien-1-ol.
| Compound Name | 6-[[ethyl(propyl)amino]methyl]-4-[(7-iodoquinolin-4-yl)amino]cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 153301338 |
| Molecular Formula | C21H26IN3O |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 6-[[ethyl(propyl)amino]methyl]-4-[(7-iodoquinolin-4-yl)amino]cyclohexa-2,4-dien-1-ol |
| SMILES | CCCN(CC)CC1C=C(Nc2ccnc3cc(I)ccc23)C=CC1O |
| InChI | InChI=1S/C21H26IN3O/c1-3-11-25(4-2)14-15-12-17(6-8-21(15)26)24-19-9-10-23-20-13-16(22)5-7-18(19)20/h5-10,12-13,15,21,26H,3-4,11,14H2,1-2H3,(H,23,24) |
| InChIKey | XWPYKSFMVIEJDN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|