C24H20F2N2S — CID 135360731
12-(3,4-difluorophenyl)-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthroline-11-thione (PubChem CID 135360731) has the molecular formula C24H20F2N2S and a molecular weight of 406.50 g/mol. Its IUPAC name is 12-(3,4-difluorophenyl)-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthroline-11-thione.
| Compound Name | 12-(3,4-difluorophenyl)-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthroline-11-thione |
|---|---|
| PubChem CID | 135360731 |
| Molecular Formula | C24H20F2N2S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 12-(3,4-difluorophenyl)-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthroline-11-thione |
| SMILES | CC1(C)CC(=S)C2=C(C1)Nc1ccc3ncccc3c1C2c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C24H20F2N2S/c1-24(2)11-19-23(20(29)12-24)21(13-5-6-15(25)16(26)10-13)22-14-4-3-9-27-17(14)7-8-18(22)28-19/h3-10,21,28H,11-12H2,1-2H3 |
| InChIKey | OWUSHDZKWJODPP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|