C19H27N9O2 — CID 135362019
(3aR,7aR)-4-[5-carbamoyl-6-[(1-methylpyrazol-4-yl)amino]pyrazin-2-yl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxamide (PubChem CID 135362019) has the molecular formula C19H27N9O2 and a molecular weight of 413.49 g/mol. Its IUPAC name is (3aR,7aR)-4-[5-carbamoyl-6-[(1-methylpyrazol-4-yl)amino]pyrazin-2-yl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxamide.
| Compound Name | (3aR,7aR)-4-[5-carbamoyl-6-[(1-methylpyrazol-4-yl)amino]pyrazin-2-yl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 135362019 |
| Molecular Formula | C19H27N9O2 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | (3aR,7aR)-4-[5-carbamoyl-6-[(1-methylpyrazol-4-yl)amino]pyrazin-2-yl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC[C@@H]2[C@H]1CCCN2c1cnc(C(N)=O)c(Nc2cnn(C)c2)n1 |
| InChI | InChI=1S/C19H27N9O2/c1-25(2)19(30)28-8-6-14-13(28)5-4-7-27(14)15-10-21-16(17(20)29)18(24-15)23-12-9-22-26(3)11-12/h9-11,13-14H,4-8H2,1-3H3,(H2,20,29)(H,23,24)/t13-,14-/m1/s1 |
| InChIKey | RAWFTSRPKNNEHZ-ZIAGYGMSSA-N |
| XLogP | 0.78 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |