C24H23F3N4O3S — CID 135363861
1-[2-oxo-2-[4-[4-[(Z)-phenylmethoxyiminomethyl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-3-(trifluoromethyl)pyridin-2-one (PubChem CID 135363861) has the molecular formula C24H23F3N4O3S and a molecular weight of 504.53 g/mol. Its IUPAC name is 1-[2-oxo-2-[4-[4-[(Z)-phenylmethoxyiminomethyl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-3-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-oxo-2-[4-[4-[(Z)-phenylmethoxyiminomethyl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-3-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 135363861 |
| Molecular Formula | C24H23F3N4O3S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 1-[2-oxo-2-[4-[4-[(Z)-phenylmethoxyiminomethyl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-3-(trifluoromethyl)pyridin-2-one |
| SMILES | O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCC(c2nc(/C=N\OCc3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C24H23F3N4O3S/c25-24(26,27)20-7-4-10-31(23(20)33)14-21(32)30-11-8-18(9-12-30)22-29-19(16-35-22)13-28-34-15-17-5-2-1-3-6-17/h1-7,10,13,16,18H,8-9,11-12,14-15H2/b28-13- |
| InChIKey | QVRBCWFBNNEPKI-QDTIIGTASA-N |
| XLogP | 4.28 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|