C14H12O6 — CID 135364269
(5-hydroxy-4-oxopyran-2-yl)methyl 2-hydroxy-5-methylbenzoate (PubChem CID 135364269) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is (5-hydroxy-4-oxopyran-2-yl)methyl 2-hydroxy-5-methylbenzoate.
| Compound Name | (5-hydroxy-4-oxopyran-2-yl)methyl 2-hydroxy-5-methylbenzoate |
|---|---|
| PubChem CID | 135364269 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (5-hydroxy-4-oxopyran-2-yl)methyl 2-hydroxy-5-methylbenzoate |
| SMILES | Cc1ccc(O)c(C(=O)OCc2cc(=O)c(O)co2)c1 |
| InChI | InChI=1S/C14H12O6/c1-8-2-3-11(15)10(4-8)14(18)20-6-9-5-12(16)13(17)7-19-9/h2-5,7,15,17H,6H2,1H3 |
| InChIKey | GPGQJQCNVXISPU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |