C15H12F3NO2 — CID 135366913
(3S)-3-amino-3-[5-(2,4-difluorophenyl)-2-fluorophenyl]propanoic acid (PubChem CID 135366913) has the molecular formula C15H12F3NO2 and a molecular weight of 295.26 g/mol. Its IUPAC name is (3S)-3-amino-3-[5-(2,4-difluorophenyl)-2-fluorophenyl]propanoic acid.
| Compound Name | (3S)-3-amino-3-[5-(2,4-difluorophenyl)-2-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 135366913 |
| Molecular Formula | C15H12F3NO2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (3S)-3-amino-3-[5-(2,4-difluorophenyl)-2-fluorophenyl]propanoic acid |
| SMILES | N[C@@H](CC(=O)O)c1cc(-c2ccc(F)cc2F)ccc1F |
| InChI | InChI=1S/C15H12F3NO2/c16-9-2-3-10(13(18)6-9)8-1-4-12(17)11(5-8)14(19)7-15(20)21/h1-6,14H,7,19H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | MVZDBUIZWYSMAC-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |